Information card for entry 2233105
| Chemical name |
2,2'-[Imidazolidine-1,3-diylbis(methylene)]diphenol |
| Formula |
C17 H20 N2 O2 |
| Calculated formula |
C17 H20 N2 O2 |
| SMILES |
Oc1c(cccc1)CN1CN(CC1)Cc1c(O)cccc1 |
| Title of publication |
2,2'-[Imidazolidine-1,3-diylbis(methylene)]diphenol |
| Authors of publication |
Rivera, Augusto; Nerio, Luz Stella; Ríos-Motta, Jaime; Fejfarová, Karla; Dušek, Michal |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o170 - o171 |
| a |
9.6541 ± 0.0006 Å |
| b |
9.5198 ± 0.0011 Å |
| c |
16.0007 ± 0.0019 Å |
| α |
90° |
| β |
97.321 ± 0.007° |
| γ |
90° |
| Cell volume |
1458.6 ± 0.3 Å3 |
| Cell temperature |
120 K |
| Ambient diffraction temperature |
120 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0363 |
| Residual factor for significantly intense reflections |
0.0323 |
| Weighted residual factors for significantly intense reflections |
0.0984 |
| Weighted residual factors for all reflections included in the refinement |
0.1015 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.84 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233105.html
