Information card for entry 2233118
| Chemical name |
3,3'-[Biphenyl-4,4'-diylbis(oxy)]diphthalic acid |
| Formula |
C28 H18 O10 |
| Calculated formula |
C28 H18 O10 |
| SMILES |
C(=O)(c1c(C(=O)O)c(ccc1)Oc1ccc(cc1)c1ccc(cc1)Oc1c(C(=O)O)c(C(=O)O)ccc1)O |
| Title of publication |
3,3'-[Biphenyl-4,4'-diylbis(oxy)]diphthalic acid |
| Authors of publication |
Zhao, Ningning; Li, Wenjun; Chang, Zhidong; Sun, Changyan; Fan, Hongxia |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o211 |
| a |
21.5817 ± 0.0007 Å |
| b |
11.2676 ± 0.0004 Å |
| c |
9.5025 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2310.76 ± 0.13 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0617 |
| Residual factor for significantly intense reflections |
0.0478 |
| Weighted residual factors for significantly intense reflections |
0.1109 |
| Weighted residual factors for all reflections included in the refinement |
0.1175 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.084 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233118.html