Information card for entry 2233278
| Chemical name |
<i>rac</i>-Diethyl 5-oxo-2-[(2,4,4-trimethylpentan-2-yl)amino]- 4,5-dihydropyrano[3,2-<i>c</i>]chromene-3,4-dicarboxylate |
| Formula |
C26 H33 N O7 |
| Calculated formula |
C26 H33 N O7 |
| SMILES |
c12ccccc1c1c(c(=O)o2)C(C(=C(O1)NC(C)(CC(C)(C)C)C)C(=O)OCC)C(=O)OCC |
| Title of publication |
<i>rac</i>-Diethyl 5-oxo-2-[(2,4,4-trimethylpentan-2-yl)amino]-4,5-dihydropyrano[3,2-<i>c</i>]chromene-3,4-dicarboxylate |
| Authors of publication |
Inglebert, S. Antony; Sethusankar, K.; Arun, Yuvaraj; Perumal, Paramasivam T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o112 |
| a |
11.691 ± 0.0017 Å |
| b |
18.786 ± 0.003 Å |
| c |
11.7305 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2576.3 ± 0.6 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0847 |
| Residual factor for significantly intense reflections |
0.0488 |
| Weighted residual factors for significantly intense reflections |
0.1197 |
| Weighted residual factors for all reflections included in the refinement |
0.1477 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.094 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233278.html