Information card for entry 2233280
| Chemical name |
3,3'-Bis(quinolin-8-yl)-1,1'-[4,4'-methylenebis(4,1-phenylene)]diurea |
| Formula |
C33 H26 N6 O2 |
| Calculated formula |
C33 H26 N6 O2 |
| SMILES |
n1cccc2cccc(c12)NC(=O)Nc1ccc(cc1)Cc1ccc(cc1)NC(=O)Nc1cccc2cccnc12 |
| Title of publication |
3,3'-Bis(quinolin-8-yl)-1,1'-[4,4'-methylenebis(4,1-phenylene)]diurea |
| Authors of publication |
Pramanik, Avijit; Russ, Tiffany H.; Powell, Douglas R.; Hossain, Md. Alamgir |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o158 - o159 |
| a |
18.1345 ± 0.0006 Å |
| b |
18.1345 ± 0.0006 Å |
| c |
17.1405 ± 0.0011 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5636.8 ± 0.4 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
78 |
| Hermann-Mauguin space group symbol |
P 43 |
| Hall space group symbol |
P 4cw |
| Residual factor for all reflections |
0.065 |
| Residual factor for significantly intense reflections |
0.046 |
| Weighted residual factors for significantly intense reflections |
0.096 |
| Weighted residual factors for all reflections included in the refinement |
0.104 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233280.html