Information card for entry 2233299
| Chemical name |
1,2-Bis[(1,3-benzodioxol-5-yl)methylidene]hydrazine |
| Formula |
C16 H12 N2 O4 |
| Calculated formula |
C16 H12 N2 O4 |
| SMILES |
N(=C\c1ccc2c(c1)OCO2)/N=C/c1ccc2c(c1)OCO2 |
| Title of publication |
1,2-Bis[(1,3-benzodioxol-5-yl)methylidene]hydrazine |
| Authors of publication |
Jasinski, Jerry P.; Golen, James A.; Praveen, A. S.; Narayana, B.; Yathirajan, H. S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o7 |
| a |
6.1835 ± 0.0002 Å |
| b |
4.597 ± 0.0002 Å |
| c |
23.8487 ± 0.001 Å |
| α |
90° |
| β |
96.08 ± 0.004° |
| γ |
90° |
| Cell volume |
674.1 ± 0.05 Å3 |
| Cell temperature |
170 ± 2 K |
| Ambient diffraction temperature |
170 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0552 |
| Residual factor for significantly intense reflections |
0.0427 |
| Weighted residual factors for significantly intense reflections |
0.1103 |
| Weighted residual factors for all reflections included in the refinement |
0.1183 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233299.html