Information card for entry 2233331
| Chemical name |
3-Hydroxy-4-phenyl-1-(prop-2-en-1-yl)-2,3,4,5-tetrahydro-1<i>H</i>- 1,5-benzodiazepin-2-one |
| Formula |
C18 H18 N2 O2 |
| Calculated formula |
C18 H18 N2 O2 |
| SMILES |
C=CCN1c2ccccc2N[C@@H]([C@H](C1=O)O)c1ccccc1.C=CCN1c2ccccc2N[C@H]([C@@H](C1=O)O)c1ccccc1 |
| Title of publication |
3-Hydroxy-4-phenyl-1-(prop-2-en-1-yl)-2,3,4,5-tetrahydro-1<i>H</i>-1,5-benzodiazepin-2-one |
| Authors of publication |
Rida, Mohamed; Mamari, Khalil; Essassi, El Mokhtar; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o238 |
| a |
51.6665 ± 0.0008 Å |
| b |
14.5766 ± 0.0002 Å |
| c |
11.9316 ± 0.0002 Å |
| α |
90° |
| β |
90.965 ± 0.002° |
| γ |
90° |
| Cell volume |
8984.7 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0682 |
| Residual factor for significantly intense reflections |
0.0522 |
| Weighted residual factors for significantly intense reflections |
0.1393 |
| Weighted residual factors for all reflections included in the refinement |
0.153 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.011 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233331.html