Information card for entry 2233349
| Chemical name |
(<i>E</i>)-3-(2,4-Dimethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| Formula |
C20 H22 O6 |
| Calculated formula |
C20 H22 O6 |
| SMILES |
O=C(/C=C/c1c(OC)cc(OC)cc1)c1cc(OC)c(OC)c(OC)c1 |
| Title of publication |
(<i>E</i>)-3-(2,4-Dimethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| Authors of publication |
Wu, Jianzhang; Qiu, Junyan; Wu, Xiaokai; Yang, Shulin; Liu, Yonggen |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o154 |
| a |
8.3111 ± 0.0011 Å |
| b |
13.8493 ± 0.0017 Å |
| c |
15.887 ± 0.002 Å |
| α |
90° |
| β |
101.588 ± 0.002° |
| γ |
90° |
| Cell volume |
1791.4 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0675 |
| Residual factor for significantly intense reflections |
0.0462 |
| Weighted residual factors for significantly intense reflections |
0.1164 |
| Weighted residual factors for all reflections included in the refinement |
0.1263 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.969 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233349.html