Information card for entry 2233426
| Chemical name |
3-Fluoro-12<i>H</i>-benzimidazo[2,1-<i>b</i>][1,3]benzothiazin-12-one |
| Formula |
C14 H7 F N2 O S |
| Calculated formula |
C14 H7 F N2 O S |
| SMILES |
S1c2nc3c(n2C(=O)c2c1cc(F)cc2)cccc3 |
| Title of publication |
3-Fluoro-12<i>H</i>-benzimidazo[2,1-<i>b</i>][1,3]benzothiazin-12-one |
| Authors of publication |
Wang, Zhiming; Yu, Bin; Zhang, Xiuqin; Cui, Yuan; Sun, Xiaoqiang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
o390 |
| a |
9.5027 ± 0.0012 Å |
| b |
7.0759 ± 0.0009 Å |
| c |
16.931 ± 0.002 Å |
| α |
90° |
| β |
94.375 ± 0.003° |
| γ |
90° |
| Cell volume |
1135.1 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0445 |
| Residual factor for significantly intense reflections |
0.0359 |
| Weighted residual factors for significantly intense reflections |
0.1018 |
| Weighted residual factors for all reflections included in the refinement |
0.1062 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.999 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233426.html