Information card for entry 2233508
| Chemical name |
Bis[4-amino-3,5-bis(pyridin-2-yl)-4<i>H</i>-1,2,4-triazole- κ^2^<i>N</i>^2^,<i>N</i>^3^]bis(benzene-1,2-dicarboxylic acid-κ<i>O</i>)copper(II) bis(2-carboxybenzoate) |
| Formula |
C56 H42 Cu N12 O16 |
| Calculated formula |
C56 H42 Cu N12 O16 |
| SMILES |
OC(=O)c1ccccc1C(=O)[O-].OC(=O)c1ccccc1C(=O)[O-].OC(=O)c1ccccc1C(=[O][Cu]12([O]=C(c3ccccc3C(=O)O)O)([n]3ccccc3c3[n]2nc(n3N)c2ccccn2)[n]2ccccc2c2[n]1nc(n2N)c1ccccn1)O |
| Title of publication |
Bis[4-amino-3,5-bis(pyridin-2-yl)-4<i>H</i>-1,2,4-triazole-κ^2^<i>N</i>^2^,<i>N</i>^3^]bis(benzene-1,2-dicarboxylic acid-κ<i>O</i>)copper(II) bis(2-carboxybenzoate) |
| Authors of publication |
Yan, Yan; Yu, Wen-Jing; Chen, Jing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
m129 - m130 |
| a |
12.1171 ± 0.0007 Å |
| b |
15.9875 ± 0.001 Å |
| c |
15.7498 ± 0.0007 Å |
| α |
90° |
| β |
121.739 ± 0.003° |
| γ |
90° |
| Cell volume |
2594.8 ± 0.3 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0491 |
| Residual factor for significantly intense reflections |
0.0345 |
| Weighted residual factors for significantly intense reflections |
0.0909 |
| Weighted residual factors for all reflections included in the refinement |
0.0977 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233508.html