Information card for entry 2233523
| Chemical name |
1,1,4,4-Tetra-<i>tert</i>-butyl-1,4-dichloro-2,2,3,3-tetraphenyltetrasilane |
| Formula |
C40 H56 Cl2 Si4 |
| Calculated formula |
C40 H56 Cl2 Si4 |
| SMILES |
C(C)(C)([Si](Cl)(C(C)(C)C)[Si](c1ccccc1)(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)[Si](C(C)(C)C)(C(C)(C)C)Cl)C |
| Title of publication |
1,1,4,4-Tetra-<i>tert</i>-butyl-1,4-dichloro-2,2,3,3-tetraphenyltetrasilane |
| Authors of publication |
Otsuka, Kyohei; Ishida, Shintaro; Kyushin, Soichiro |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
o424 |
| a |
9.6981 ± 0.0008 Å |
| b |
15.3893 ± 0.0011 Å |
| c |
13.8546 ± 0.0011 Å |
| α |
90° |
| β |
105.772 ± 0.0007° |
| γ |
90° |
| Cell volume |
1989.9 ± 0.3 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0382 |
| Residual factor for significantly intense reflections |
0.0374 |
| Weighted residual factors for significantly intense reflections |
0.0933 |
| Weighted residual factors for all reflections included in the refinement |
0.0937 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.097 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233523.html