Information card for entry 2233545
| Chemical name |
(<i>E</i>)-9-(4-Chlorostyryl)-3,4,5,6,7,9-hexahydro-2<i>H</i>-xanthene- 1,8-dione |
| Formula |
C21 H19 Cl O3 |
| Calculated formula |
C21 H19 Cl O3 |
| SMILES |
Clc1ccc(cc1)/C=C/C1C2=C(OC3=C1C(=O)CCC3)CCCC2=O |
| Title of publication |
(<i>E</i>)-9-(4-Chlorostyryl)-3,4,5,6,7,9-hexahydro-2<i>H</i>-xanthene-1,8-dione |
| Authors of publication |
Lee, Jae Kyun; Pae, Ae Nim; Cho, Yong Seo; Cha, Joo Hwan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
o501 |
| a |
5.6262 ± 0.0007 Å |
| b |
16.273 ± 0.002 Å |
| c |
18.57 ± 0.003 Å |
| α |
90° |
| β |
90.125 ± 0.004° |
| γ |
90° |
| Cell volume |
1700.2 ± 0.4 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for significantly intense reflections |
0.0585 |
| Weighted residual factors for all reflections included in the refinement |
0.1571 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.946 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233545.html