Information card for entry 2233553
| Chemical name |
Ethyl 1-(2,4-dichlorobenzyl)-4-oxo-7-trifluoromethyl-1,4-dihydroquinoline-3- carboxylate |
| Formula |
C20 H14 Cl2 F3 N O3 |
| Calculated formula |
C20 H14 Cl2 F3 N O3 |
| SMILES |
CCOC(=O)c1cn(Cc2ccc(cc2Cl)Cl)c2c(c1=O)ccc(c2)C(F)(F)F |
| Title of publication |
Ethyl 1-(2,4-dichlorobenzyl)-4-oxo-7-trifluoromethyl-1,4-dihydroquinoline-3-carboxylate |
| Authors of publication |
Fun, Hoong-Kun; Ooi, Chin Wei; Garudachari, B.; Isloor, Arun M.; Hegde, Gurumurthy |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
o435 - o436 |
| a |
8.09 ± 0.002 Å |
| b |
9.547 ± 0.003 Å |
| c |
14.047 ± 0.004 Å |
| α |
77.299 ± 0.006° |
| β |
76.198 ± 0.005° |
| γ |
67.488 ± 0.004° |
| Cell volume |
963.3 ± 0.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1083 |
| Residual factor for significantly intense reflections |
0.0562 |
| Weighted residual factors for significantly intense reflections |
0.1457 |
| Weighted residual factors for all reflections included in the refinement |
0.1794 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233553.html