Information card for entry 2233561
| Chemical name |
1-(6-Methyl-3-phenyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidin-5-yl)ethanone |
| Formula |
C13 H14 N2 O S |
| Calculated formula |
C13 H14 N2 O S |
| SMILES |
S=C1NC(=C(CN1c1ccccc1)C(=O)C)C |
| Title of publication |
1-(6-Methyl-3-phenyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidin-5-yl)ethanone |
| Authors of publication |
Garibov, Emin N.; Gojayeva, Sevinj S.; Allahverdiyev, Mirze A.; Gurbanov, Atash V. Gurbanov; Brito, Iván |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
o276 |
| a |
24.3527 ± 0.001 Å |
| b |
7.2374 ± 0.0003 Å |
| c |
7.0063 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1234.86 ± 0.09 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0545 |
| Residual factor for significantly intense reflections |
0.0513 |
| Weighted residual factors for significantly intense reflections |
0.1365 |
| Weighted residual factors for all reflections included in the refinement |
0.1406 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233561.html