Information card for entry 2233579
| Chemical name |
2,4-Diphenyl-6-trifluoromethyl-2,3-dihydro-1<i>H</i>,5<i>H</i>- pyrrolo[3,4-<i>c</i>]pyrrole-1,3-dione |
| Formula |
C19 H11 F3 N2 O2 |
| Calculated formula |
C19 H11 F3 N2 O2 |
| SMILES |
[nH]1c(c2C(=O)N(C(=O)c2c1c1ccccc1)c1ccccc1)C(F)(F)F |
| Title of publication |
2,4-Diphenyl-6-trifluoromethyl-2,3-dihydro-1<i>H</i>,5<i>H</i>-pyrrolo[3,4-<i>c</i>]pyrrole-1,3-dione |
| Authors of publication |
Roberts, Sue A.; Martinez-Ariza, Guillermo; Dietrich, Justin; Hulme, Christopher |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
o496 - o497 |
| a |
10.473 ± 0.0004 Å |
| b |
12.2394 ± 0.0005 Å |
| c |
13.4379 ± 0.0005 Å |
| α |
67.542 ± 0.002° |
| β |
82.511 ± 0.002° |
| γ |
80.294 ± 0.002° |
| Cell volume |
1564.98 ± 0.11 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0414 |
| Residual factor for significantly intense reflections |
0.0358 |
| Weighted residual factors for significantly intense reflections |
0.0851 |
| Weighted residual factors for all reflections included in the refinement |
0.089 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.983 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233579.html