Information card for entry 2233607
| Chemical name |
3,3-Dimethyl-1,2,3,4-tetrahydrocyclopenta[<i>b</i>]indole-1,2-dione |
| Formula |
C13 H11 N O2 |
| Calculated formula |
C13 H11 N O2 |
| SMILES |
[nH]1c2c(c3C(=O)C(=O)C(c13)(C)C)cccc2 |
| Title of publication |
3,3-Dimethyl-1,2,3,4-tetrahydrocyclopenta[<i>b</i>]indole-1,2-dione (bruceolline E) |
| Authors of publication |
Jordon, Jason A.; Badenock, Jeanese C.; Gribble, Gordon W.; Jasinski, Jerry P.; Golen, James A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
o364 - o365 |
| a |
9.1091 ± 0.0007 Å |
| b |
11.5337 ± 0.0008 Å |
| c |
11.8745 ± 0.0009 Å |
| α |
63.23 ± 0.007° |
| β |
80.596 ± 0.006° |
| γ |
79.97 ± 0.006° |
| Cell volume |
1091.69 ± 0.16 Å3 |
| Cell temperature |
170 ± 2 K |
| Ambient diffraction temperature |
170 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0639 |
| Residual factor for significantly intense reflections |
0.0533 |
| Weighted residual factors for significantly intense reflections |
0.1472 |
| Weighted residual factors for all reflections included in the refinement |
0.1573 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233607.html