Information card for entry 2233644
| Chemical name |
1,3-Bis(biphenyl-4-yl)-2,2-dibromo-3-oxopropyl acetate |
| Formula |
C29 H22 Br2 O3 |
| Calculated formula |
C29 H22 Br2 O3 |
| SMILES |
BrC(Br)(C(OC(=O)C)c1ccc(cc1)c1ccccc1)C(=O)c1ccc(cc1)c1ccccc1 |
| Title of publication |
1,3-Bis(biphenyl-4-yl)-2,2-dibromo-3-oxopropyl acetate |
| Authors of publication |
Jasinski, Jerry P.; Golen, James A.; Siddaraju, B. P.; Narayana, B.; Yathirajan, H. S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
o362 - o363 |
| a |
12.0497 ± 0.0014 Å |
| b |
20.842 ± 0.002 Å |
| c |
9.9482 ± 0.001 Å |
| α |
90° |
| β |
98.743 ± 0.01° |
| γ |
90° |
| Cell volume |
2469.4 ± 0.5 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.099 |
| Residual factor for significantly intense reflections |
0.0516 |
| Weighted residual factors for significantly intense reflections |
0.1092 |
| Weighted residual factors for all reflections included in the refinement |
0.1304 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.019 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233644.html