Information card for entry 2233657
| Chemical name |
Bis(acetato-κ^2^<i>O</i>,<i>O</i>')(2,2':6',2''- terpyridine-κ^3^<i>N</i>,<i>N</i>',<i>N</i>'')manganese(II) dihydrate |
| Formula |
C19 H21 Mn N3 O6 |
| Calculated formula |
C19 H21 Mn N3 O6 |
| SMILES |
[Mn]1234([O]=C(O1)C)([O]=C(O2)C)[n]1c(cccc1c1[n]4cccc1)c1[n]3cccc1.O.O |
| Title of publication |
Bis(acetato-κ^2^<i>O</i>,<i>O</i>')(2,2':6',2''-terpyridine-κ^3^<i>N</i>,<i>N</i>',<i>N</i>'')manganese(II) dihydrate |
| Authors of publication |
Ha, Kwang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
m124 |
| a |
8.4367 ± 0.001 Å |
| b |
22.921 ± 0.002 Å |
| c |
11.4952 ± 0.0011 Å |
| α |
90° |
| β |
116.532 ± 0.007° |
| γ |
90° |
| Cell volume |
1988.8 ± 0.4 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1308 |
| Residual factor for significantly intense reflections |
0.0545 |
| Weighted residual factors for significantly intense reflections |
0.1119 |
| Weighted residual factors for all reflections included in the refinement |
0.1462 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.926 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233657.html