Information card for entry 2233663
| Chemical name |
Diaquabis{1-[(1<i>H</i>-benzimidazol-2-yl)methyl]-1<i>H</i>-1,2,4-triazole- κ<i>N</i>^4^}bis(2,4,5-tricarboxybenzoato-κ<i>O</i>^1^)cadmium dihydrate |
| Formula |
C40 H36 Cd N10 O20 |
| Calculated formula |
C40 H36 Cd N10 O20 |
| SMILES |
C(=O)(c1c(C(=O)O)cc(C(=O)O)c(C(=O)O)c1)O[Cd]([n]1cnn(c1)Cc1nc2ccccc2[nH]1)([n]1cnn(c1)Cc1nc2ccccc2[nH]1)(OC(=O)c1c(C(=O)O)cc(C(=O)O)c(C(=O)O)c1)([OH2])[OH2].O.O |
| Title of publication |
Diaquabis{1-[(1<i>H</i>-benzimidazol-2-yl)methyl]-1<i>H</i>-1,2,4-triazole-κ<i>N</i>^4^}bis(2,4,5-tricarboxybenzoato-κ<i>O</i>^1^)cadmium dihydrate |
| Authors of publication |
Zhao, Lei; Liu, Bingtao; Jin, Guanghua; Meng, Xiangru |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
2 |
| Pages of publication |
m139 - m140 |
| a |
7.7005 ± 0.0015 Å |
| b |
8.6131 ± 0.0017 Å |
| c |
17.46 ± 0.003 Å |
| α |
75.98 ± 0.03° |
| β |
82.55 ± 0.03° |
| γ |
70.6 ± 0.03° |
| Cell volume |
1058.2 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0345 |
| Residual factor for significantly intense reflections |
0.0326 |
| Weighted residual factors for significantly intense reflections |
0.0822 |
| Weighted residual factors for all reflections included in the refinement |
0.0836 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233663.html