Information card for entry 2233756
| Chemical name |
2,6-Bis[(<i>S</i>)-1-phenylethyl]-1<i>H</i>,5<i>H</i>- pyrrolo[3,4-<i>f</i>]isoindole-1,3,5,7(2<i>H</i>,6<i>H</i>)-tetrone |
| Formula |
C26 H20 N2 O4 |
| Calculated formula |
C26 H20 N2 O4 |
| SMILES |
O=C1N([C@@H](c2ccccc2)C)C(=O)c2c1cc1c(c2)C(=O)N(C1=O)[C@H](C)c1ccccc1 |
| Title of publication |
2,6-Bis[(<i>S</i>)-1-phenylethyl]-1<i>H</i>,5<i>H</i>-pyrrolo[3,4-<i>f</i>]isoindole-1,3,5,7(2<i>H</i>,6<i>H</i>)-tetrone |
| Authors of publication |
Abdel-Aziz, Alaa A.-M.; El-Azab, Adel S.; Alanazi, Amer M.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o907 |
| a |
5.6401 ± 0.0001 Å |
| b |
16.104 ± 0.0002 Å |
| c |
11.3759 ± 0.0002 Å |
| α |
90° |
| β |
99.762 ± 0.002° |
| γ |
90° |
| Cell volume |
1018.29 ± 0.03 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0326 |
| Residual factor for significantly intense reflections |
0.0326 |
| Weighted residual factors for significantly intense reflections |
0.0992 |
| Weighted residual factors for all reflections included in the refinement |
0.0992 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.114 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233756.html