Information card for entry 2233864
| Chemical name |
6-(2-Methylpropyl)-4-oxo-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5- carbonitrile |
| Formula |
C9 H11 N3 O S |
| Calculated formula |
C9 H11 N3 O S |
| SMILES |
S=C1NC(=C(C(=O)N1)C#N)CC(C)C |
| Title of publication |
6-(2-Methylpropyl)-4-oxo-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carbonitrile |
| Authors of publication |
Al-Deeb, Omar A.; El-Emam, Ali A.; Al-Turkistani, Abdulghafoor A.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o676 - o677 |
| a |
25.8985 ± 0.0006 Å |
| b |
7.0479 ± 0.0002 Å |
| c |
11.1811 ± 0.0002 Å |
| α |
90° |
| β |
98.527 ± 0.002° |
| γ |
90° |
| Cell volume |
2018.33 ± 0.08 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0311 |
| Residual factor for significantly intense reflections |
0.0297 |
| Weighted residual factors for significantly intense reflections |
0.0841 |
| Weighted residual factors for all reflections included in the refinement |
0.0857 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.034 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233864.html