Information card for entry 2233944
| Chemical name |
7-Benzyl-3-(4-chlorophenyl)-2-isobutylamino-5,6,7,8- tetrahydropyrido[4',3':4,5]thieno[2,3-<i>d</i>]pyrimidin-4(3<i>H</i>)-one |
| Formula |
C26 H27 Cl N4 O S |
| Calculated formula |
C26 H27 Cl N4 O S |
| SMILES |
Clc1ccc(cc1)n1c(nc2c(c3CCN(Cc4ccccc4)Cc3s2)c1=O)NCC(C)C |
| Title of publication |
7-Benzyl-3-(4-chlorophenyl)-2-isobutylamino-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-<i>d</i>]pyrimidin-4(3<i>H</i>)-one |
| Authors of publication |
Chen, Hong; Liao, Quan-Bin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o822 |
| a |
17.428 ± 0.013 Å |
| b |
9.391 ± 0.007 Å |
| c |
16.17 ± 0.013 Å |
| α |
90° |
| β |
111.995 ± 0.007° |
| γ |
90° |
| Cell volume |
2454 ± 3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1084 |
| Residual factor for significantly intense reflections |
0.0703 |
| Weighted residual factors for significantly intense reflections |
0.1459 |
| Weighted residual factors for all reflections included in the refinement |
0.1636 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.058 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233944.html