Information card for entry 2234056
| Chemical name |
Ethyl 4-methyl-1,3-dioxo-1,2,3,4-tetrahydroisoquinoline-4-carboxylate |
| Formula |
C13 H13 N O4 |
| Calculated formula |
C13 H13 N O4 |
| SMILES |
CCOC(=O)C1(C)C(=O)NC(=O)c2c1cccc2 |
| Title of publication |
Ethyl 4-methyl-1,3-dioxo-1,2,3,4-tetrahydroisoquinoline-4-carboxylate |
| Authors of publication |
Li, Xing-Yao; Wu, Jin-Long |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o891 |
| a |
6.4585 ± 0.0009 Å |
| b |
8.1999 ± 0.0007 Å |
| c |
12.5763 ± 0.0011 Å |
| α |
78.876 ± 0.007° |
| β |
77.228 ± 0.009° |
| γ |
72.354 ± 0.009° |
| Cell volume |
613.28 ± 0.12 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0704 |
| Residual factor for significantly intense reflections |
0.0494 |
| Weighted residual factors for significantly intense reflections |
0.1193 |
| Weighted residual factors for all reflections included in the refinement |
0.1346 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234056.html