Information card for entry 2234063
| Chemical name |
3,6-Dimethyl-<i>N</i>^1^,<i>N</i>^4^-bis(pyridin-2-yl)-1,2,4,5-tetrazine-1,4- dicarboxamide |
| Formula |
C16 H16 N8 O2 |
| Calculated formula |
C16 H16 N8 O2 |
| SMILES |
N1(N=C(N(N=C1C)C(=O)Nc1ncccc1)C)C(=O)Nc1ncccc1 |
| Title of publication |
3,6-Dimethyl-<i>N</i>^1^,<i>N</i>^4^-bis(pyridin-2-yl)-1,2,4,5-tetrazine-1,4-dicarboxamide |
| Authors of publication |
Rao, Guo-Wu; Guo, Yan-Mei; Shen, Qun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
3 |
| Pages of publication |
o702 - o703 |
| a |
11.753 ± 0.002 Å |
| b |
20.081 ± 0.004 Å |
| c |
7.2012 ± 0.0014 Å |
| α |
90° |
| β |
96.273 ± 0.003° |
| γ |
90° |
| Cell volume |
1689.4 ± 0.6 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0723 |
| Residual factor for significantly intense reflections |
0.0611 |
| Weighted residual factors for significantly intense reflections |
0.173 |
| Weighted residual factors for all reflections included in the refinement |
0.1822 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.065 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234063.html