Information card for entry 2234251
| Chemical name |
4-[(1,3-Thiazol-2-yl)sulfamoyl]phenyl 2,2,2-trifluoroacetate |
| Formula |
C11 H7 F3 N2 O4 S2 |
| Calculated formula |
C11 H7 F3 N2 O4 S2 |
| SMILES |
s1ccnc1NS(=O)(=O)c1ccc(OC(=O)C(F)(F)F)cc1 |
| Title of publication |
4-[(1,3-Thiazol-2-yl)sulfamoyl]phenyl 2,2,2-trifluoroacetate |
| Authors of publication |
Asiri, Abdullah M.; Faidallah, Hassan M.; Alamry, Khalid A.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o1156 |
| a |
8.7498 ± 0.0005 Å |
| b |
14.4343 ± 0.0009 Å |
| c |
10.7225 ± 0.0005 Å |
| α |
90° |
| β |
96.749 ± 0.005° |
| γ |
90° |
| Cell volume |
1344.84 ± 0.13 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.098 |
| Residual factor for significantly intense reflections |
0.0706 |
| Weighted residual factors for significantly intense reflections |
0.191 |
| Weighted residual factors for all reflections included in the refinement |
0.2153 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.061 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234251.html