Information card for entry 2234339
| Chemical name |
4-(Dimethoxymethyl)phenyl 2,3,4,6-tetra-<i>O</i>-acetyl-β-<i>D</i>-glucopyranoside |
| Formula |
C23 H30 O12 |
| Calculated formula |
C23 H30 O12 |
| SMILES |
[C@H]1([C@H]([C@@H]([C@H]([C@H](COC(=O)C)O1)OC(=O)C)OC(=O)C)OC(=O)C)Oc1ccc(cc1)C(OC)OC |
| Title of publication |
4-(Dimethoxymethyl)phenyl 2,3,4,6-tetra-<i>O</i>-acetyl-β-<small>D</small>-glucopyranoside |
| Authors of publication |
Zipp, Caitlin F.; Fernandes, Manuel; Marques, Helder M.; Michael, Joseph P. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o1202 |
| a |
7.9004 ± 0.0002 Å |
| b |
10.9961 ± 0.0003 Å |
| c |
29.2289 ± 0.0008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2539.22 ± 0.12 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0614 |
| Residual factor for significantly intense reflections |
0.0424 |
| Weighted residual factors for significantly intense reflections |
0.0948 |
| Weighted residual factors for all reflections included in the refinement |
0.1016 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.966 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234339.html