Information card for entry 2234355
| Chemical name |
Ethyl 2-(7-oxo-3,5-diphenyl-1,4-diazepan-2-yl)acetate |
| Formula |
C21 H24 N2 O3 |
| Calculated formula |
C21 H24 N2 O3 |
| SMILES |
CCOC(=O)C[C@H]1NC(=O)C[C@@H](N[C@@H]1c1ccccc1)c1ccccc1.CCOC(=O)C[C@@H]1NC(=O)C[C@H](N[C@H]1c1ccccc1)c1ccccc1 |
| Title of publication |
Ethyl 2-(7-oxo-3,5-diphenyl-1,4-diazepan-2-yl)acetate |
| Authors of publication |
Jagadeesan, G.; Sethusankar, K.; Selvakumar, P.; Thennarasu, S.; Mandal, A. B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o1034 |
| a |
10.3721 ± 0.0019 Å |
| b |
20.666 ± 0.004 Å |
| c |
9.1954 ± 0.0018 Å |
| α |
90° |
| β |
104.365 ± 0.005° |
| γ |
90° |
| Cell volume |
1909.4 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0876 |
| Residual factor for significantly intense reflections |
0.0536 |
| Weighted residual factors for significantly intense reflections |
0.1362 |
| Weighted residual factors for all reflections included in the refinement |
0.1628 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234355.html