Information card for entry 2234360
| Chemical name |
Bis(azido-κ<i>N</i>)bis[6-(pyridin-2-yl)-1,3,5-triazine-2,4-diamine- κ^2^<i>N</i>^1^,<i>N</i>^6^]manganese(II) |
| Formula |
C16 H16 Mn N18 |
| Calculated formula |
C16 H16 Mn N18 |
| SMILES |
c1cccc2c3[n]([Mn]4([n]12)(N=N#N)([n]1ccccc1c1nc(nc([n]41)N)N)N=N#N)c(nc(n3)N)N |
| Title of publication |
Bis(azido-κ<i>N</i>)bis[6-(pyridin-2-yl)-1,3,5-triazine-2,4-diamine-κ^2^<i>N</i>^1^,<i>N</i>^6^]manganese(II) |
| Authors of publication |
Wang, Kun-Miao; Liu, Zhi-Hua; Zheng, Qi; Liu, Chun-Bo; Miao, Ming-Ming |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
m427 |
| a |
18.33 ± 0.003 Å |
| b |
14.412 ± 0.003 Å |
| c |
9.1915 ± 0.0017 Å |
| α |
90° |
| β |
115.044 ± 0.002° |
| γ |
90° |
| Cell volume |
2199.9 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0955 |
| Residual factor for significantly intense reflections |
0.0464 |
| Weighted residual factors for significantly intense reflections |
0.088 |
| Weighted residual factors for all reflections included in the refinement |
0.1056 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.005 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234360.html