Information card for entry 2234362
| Chemical name |
Methyl 2-(2-bromobenzylidene)-5-(4-hydroxyphenyl)-7-methyl-3-oxo-2,3-dihydro- 5<i>H</i>-1,3-thiazolo[3,2-<i>a</i>]pyrimidine-6-carboxylate |
| Formula |
C22 H17 Br N2 O4 S |
| Calculated formula |
C22 H17 Br N2 O4 S |
| SMILES |
COC(=O)C1=C(C)N=C2N(C1c1ccc(cc1)O)C(=O)/C(=C/c1ccccc1Br)S2 |
| Title of publication |
Methyl 2-(2-bromobenzylidene)-5-(4-hydroxyphenyl)-7-methyl-3-oxo-2,3-dihydro-5<i>H</i>-1,3-thiazolo[3,2-<i>a</i>]pyrimidine-6-carboxylate |
| Authors of publication |
Nagarajaiah, H.; Fathima, Nikhath; Begum, Noor Shahina |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o1257 - o1258 |
| a |
9.851 ± 0.002 Å |
| b |
23.461 ± 0.006 Å |
| c |
9.416 ± 0.002 Å |
| α |
90° |
| β |
111.229 ± 0.005° |
| γ |
90° |
| Cell volume |
2028.5 ± 0.8 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.112 |
| Residual factor for significantly intense reflections |
0.0588 |
| Weighted residual factors for significantly intense reflections |
0.1394 |
| Weighted residual factors for all reflections included in the refinement |
0.1779 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234362.html