Information card for entry 2234368
| Chemical name |
(2,2'-Bipyridine-6,6'-dicarboxylato-κ^3^<i>N</i>,<i>N</i>',<i>O</i>^6^)(6'- carboxy-2,2'-bipyridine-6-carboxylato- κ^3^<i>N</i>,<i>N</i>',<i>O</i>^6^)cobalt(III) |
| Formula |
C24 H13 Co N4 O8 |
| Calculated formula |
C24 H13 Co N4 O8 |
| SMILES |
[Co]1234(OC(=O)c5[n]1c(ccc5)c1[n]2c(ccc1)C(=O)O)OC(=O)c1[n]3c(ccc1)c1[n]4c(ccc1)C(=O)[O-] |
| Title of publication |
(2,2'-Bipyridine-6,6'-dicarboxylato-κ^3^<i>N</i>,<i>N</i>',<i>O</i>^6^)(6'-carboxy-2,2'-bipyridine-6-carboxylato-κ^3^<i>N</i>,<i>N</i>',<i>O</i>^6^)cobalt(III) |
| Authors of publication |
Wang, Huimin; Gu, Xiaojun; Zhang, Bingbing; Su, Haiquan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
m411 - m412 |
| a |
9.3329 ± 0.0019 Å |
| b |
13.561 ± 0.003 Å |
| c |
16.894 ± 0.003 Å |
| α |
90° |
| β |
100.7 ± 0.03° |
| γ |
90° |
| Cell volume |
2101 ± 0.8 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0453 |
| Residual factor for significantly intense reflections |
0.0382 |
| Weighted residual factors for significantly intense reflections |
0.0872 |
| Weighted residual factors for all reflections included in the refinement |
0.0912 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.063 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234368.html