Information card for entry 2234409
| Chemical name |
(4<i>R</i>*,5<i>R</i>*)-Diethyl 2-(4-nitrophenyl)-1,3-dioxolane-4,5-dicarboxylate |
| Formula |
C15 H17 N O8 |
| Calculated formula |
C15 H17 N O8 |
| SMILES |
N(=O)(=O)c1ccc(cc1)C1O[C@H]([C@@H](O1)C(=O)OCC)C(=O)OCC |
| Title of publication |
(4<i>R</i>*,5<i>R</i>*)-Diethyl 2-(4-nitrophenyl)-1,3-dioxolane-4,5-dicarboxylate |
| Authors of publication |
Lv, Chun-Lei; Chen, Jian-Hui; Zhang, Yu-Zhe; Lu, Ding-Qiang; OuYang, Ping-Kai |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o1128 |
| a |
12.261 ± 0.003 Å |
| b |
4.52 ± 0.0009 Å |
| c |
15.656 ± 0.003 Å |
| α |
90° |
| β |
112.27 ± 0.03° |
| γ |
90° |
| Cell volume |
802.9 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.058 |
| Residual factor for significantly intense reflections |
0.0459 |
| Weighted residual factors for significantly intense reflections |
0.13 |
| Weighted residual factors for all reflections included in the refinement |
0.1421 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.006 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234409.html