Information card for entry 2234416
| Chemical name |
3,6-Dimethyl-1-phenyl-1<i>H</i>,4<i>H</i>-pyrano[2,3-<i>c</i>]pyrazol-4-one |
| Formula |
C14 H12 N2 O2 |
| Calculated formula |
C14 H12 N2 O2 |
| SMILES |
o1c(C)cc(=O)c2c1n(nc2C)c1ccccc1 |
| Title of publication |
3,6-Dimethyl-1-phenyl-1<i>H</i>,4<i>H</i>-pyrano[2,3-<i>c</i>]pyrazol-4-one |
| Authors of publication |
Asiri, Abdullah M.; Faidallah, Hassan M.; Hameed, Salem A.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o1120 |
| a |
6.72 ± 0.0006 Å |
| b |
8.2201 ± 0.0008 Å |
| c |
11.2616 ± 0.0007 Å |
| α |
93.914 ± 0.006° |
| β |
95.162 ± 0.006° |
| γ |
108.721 ± 0.008° |
| Cell volume |
583.66 ± 0.09 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0812 |
| Residual factor for significantly intense reflections |
0.0563 |
| Weighted residual factors for significantly intense reflections |
0.1344 |
| Weighted residual factors for all reflections included in the refinement |
0.1578 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234416.html