Information card for entry 2234421
| Chemical name |
Bis(4-dimethylamino-1-ethylpyridinium) bis(1,2-dicyanoethene-1,2-dithiolato-κ^2^<i>S</i>,<i>S</i>')nickelate(II) |
| Formula |
C26 H30 N8 Ni S4 |
| Calculated formula |
C26 H30 N8 Ni S4 |
| SMILES |
C1(=C(C#N)S[Ni]2(S1)SC(=C(C#N)S2)C#N)C#N.CC[n+]1ccc(N(C)C)cc1.CC[n+]1ccc(N(C)C)cc1 |
| Title of publication |
Bis(4-dimethylamino-1-ethylpyridinium) bis(1,2-dicyanoethene-1,2-dithiolato-κ^2^<i>S</i>,<i>S</i>')nickelate(II) |
| Authors of publication |
Yu, Shan-Shan; Zhou, Hong; Ren, Xiao-Ming |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
m395 |
| a |
8.1468 ± 0.0014 Å |
| b |
9.3305 ± 0.0016 Å |
| c |
11.663 ± 0.003 Å |
| α |
108.243 ± 0.003° |
| β |
100.034 ± 0.003° |
| γ |
107.83 ± 0.002° |
| Cell volume |
764.9 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0455 |
| Residual factor for significantly intense reflections |
0.037 |
| Weighted residual factors for significantly intense reflections |
0.115 |
| Weighted residual factors for all reflections included in the refinement |
0.1283 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.953 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234421.html