Information card for entry 2234428
| Chemical name |
5-Methylspiro[indoline-3,7'-[6<i>H</i>,7<i>H</i>,8<i>H</i>]pyrano[3,2- <i>c</i>:5,6-<i>c</i>']di[1]benzopyran]-2,6',8'-trione chloroform hemisolvate |
| Formula |
C27.5 H15.5 N O6 cl1.5 |
| Calculated formula |
C27 H15 N O6 |
| SMILES |
O1c2c(C3(c4c(=O)oc5c(c14)cccc5)C(=O)Nc1c3cc(cc1)C)c(=O)oc1c2cccc1 |
| Title of publication |
5-Methylspiro[indoline-3,7'-[6<i>H</i>,7<i>H</i>,8<i>H</i>]pyrano[3,2-<i>c</i>:5,6-<i>c</i>']di[1]benzopyran]-2,6',8'-trione chloroform hemisolvate |
| Authors of publication |
Almansour, Abdulrahman I.; Kumar, Raju Suresh; Arumugam, Natarajan; Vishnupriya, R.; Suresh, J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o1194 |
| a |
9.9341 ± 0.0002 Å |
| b |
19.1498 ± 0.0004 Å |
| c |
12.8279 ± 0.0002 Å |
| α |
90° |
| β |
95.078 ± 0.001° |
| γ |
90° |
| Cell volume |
2430.75 ± 0.08 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0873 |
| Residual factor for significantly intense reflections |
0.0674 |
| Weighted residual factors for significantly intense reflections |
0.1645 |
| Weighted residual factors for all reflections included in the refinement |
0.1737 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234428.html