Information card for entry 2234440
| Common name |
1,3,5-Tri(chloroformyl)benzene |
| Chemical name |
Benzene-1,3,5-tricarbonyl trichloride |
| Formula |
C9 H3 Cl3 O3 |
| Calculated formula |
C9 H3 Cl3 O3 |
| SMILES |
c1(cc(cc(c1)C(=O)Cl)C(=O)Cl)C(=O)Cl |
| Title of publication |
Benzene-1,3,5-tricarbonyl trichloride |
| Authors of publication |
Fan, Xin; Wang, Yanrong; Jin, Chengzhi; Jin, Longfei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
4 |
| Pages of publication |
o1260 |
| a |
6.023 ± 0.0013 Å |
| b |
8.3306 ± 0.0018 Å |
| c |
21.314 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1069.4 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0664 |
| Residual factor for significantly intense reflections |
0.0649 |
| Weighted residual factors for significantly intense reflections |
0.1684 |
| Weighted residual factors for all reflections included in the refinement |
0.1695 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.222 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234440.html