Information card for entry 2234503
| Chemical name |
3',6'-Bis(diethylamino)-2-[(<i>E</i>)-2-(4-hydroxy-3- methoxybenzylideneamino)ethyl]spiro[isoindoline-1,9'-xanthen]-3-one ethanol monosolvate |
| Formula |
C40 H48 N4 O5 |
| Calculated formula |
C40 H48 N4 O5 |
| SMILES |
O1c2cc(N(CC)CC)ccc2C2(N(C(=O)c3c2cccc3)CC/N=C/c2ccc(O)c(OC)c2)c2ccc(N(CC)CC)cc12.OCC |
| Title of publication |
3',6'-Bis(diethylamino)-2-[(<i>E</i>)-2-(4-hydroxy-3-methoxybenzylideneamino)ethyl]spiro[isoindoline-1,9'-xanthen]-3-one ethanol monosolvate |
| Authors of publication |
Wei, Zhen; Guo, Jinlong; Zheng, Xujun; Chen, Shunwei; Wan, Qun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
5 |
| Pages of publication |
o1479 |
| a |
16.674 ± 0.004 Å |
| b |
12.197 ± 0.003 Å |
| c |
17.936 ± 0.004 Å |
| α |
90° |
| β |
96.445 ± 0.004° |
| γ |
90° |
| Cell volume |
3624.6 ± 1.5 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0606 |
| Residual factor for significantly intense reflections |
0.0491 |
| Weighted residual factors for significantly intense reflections |
0.1122 |
| Weighted residual factors for all reflections included in the refinement |
0.1188 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.102 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234503.html