Information card for entry 2234626
| Chemical name |
2,3-Dihydro-1λ^6^,2-benzothiazine-1,1,4-trione |
| Formula |
C8 H7 N O3 S |
| Calculated formula |
C8 H7 N O3 S |
| SMILES |
S1(=O)(=O)NCC(=O)c2c1cccc2 |
| Title of publication |
2,3-Dihydro-1λ^6^,2-benzothiazine-1,1,4-trione |
| Authors of publication |
Aman, Farhana; Siddiqui, Waseeq Ahmad; Ashraf, Adnan; Tahir, M. Nawaz |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
5 |
| Pages of publication |
o1306 |
| a |
8.495 ± 0.0004 Å |
| b |
13.756 ± 0.0005 Å |
| c |
7.6677 ± 0.0003 Å |
| α |
90° |
| β |
113.214 ± 0.001° |
| γ |
90° |
| Cell volume |
823.48 ± 0.06 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0435 |
| Residual factor for significantly intense reflections |
0.0358 |
| Weighted residual factors for significantly intense reflections |
0.0928 |
| Weighted residual factors for all reflections included in the refinement |
0.0978 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234626.html