Information card for entry 2234644
| Chemical name |
2,4,6-Tris(2,4-dimethylphenyl)-1,3,5-triazine |
| Formula |
C27 H27 N3 |
| Calculated formula |
C27 H27 N3 |
| SMILES |
n1c(nc(nc1c1c(cc(cc1)C)C)c1ccc(cc1C)C)c1c(cc(cc1)C)C |
| Title of publication |
2,4,6-Tris(2,4-dimethylphenyl)-1,3,5-triazine |
| Authors of publication |
Huang, Jin-Sheng; Li, Mao-Kui; Yang, Yang-Yi; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
5 |
| Pages of publication |
o1463 - o1464 |
| a |
7.4663 ± 0.0004 Å |
| b |
15.0789 ± 0.0013 Å |
| c |
19.7266 ± 0.0012 Å |
| α |
109.016 ± 0.007° |
| β |
90.949 ± 0.005° |
| γ |
93.717 ± 0.006° |
| Cell volume |
2093.6 ± 0.3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.147 |
| Residual factor for significantly intense reflections |
0.0854 |
| Weighted residual factors for significantly intense reflections |
0.1844 |
| Weighted residual factors for all reflections included in the refinement |
0.2216 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.036 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234644.html