Information card for entry 2234719
| Chemical name |
4'-(4-Bromophenyl)-1'-methyldispiro[acenaphthylene-1,2'-pyrrolidine- 3',2''-indane]-2,1''(1<i>H</i>)-dione |
| Formula |
C30 H22 Br N O2 |
| Calculated formula |
C30 H22 Br N O2 |
| SMILES |
Brc1ccc([C@@H]2[C@@]3([C@@]4(N(C2)C)C(=O)c2cccc5cccc4c25)Cc2ccccc2C3=O)cc1.Brc1ccc([C@H]2[C@]3([C@]4(N(C2)C)C(=O)c2cccc5cccc4c25)Cc2ccccc2C3=O)cc1 |
| Title of publication |
4'-(4-Bromophenyl)-1'-methyldispiro[acenaphthylene-1,2'-pyrrolidine-3',2''-indane]-2,1''(1<i>H</i>)-dione |
| Authors of publication |
Wei, Ang Chee; Ali, Mohamed Ashraf; Choon, Tan Soo; Arshad, Suhana; Razak, Ibrahim Abdul |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
5 |
| Pages of publication |
o1340 - o1341 |
| a |
8.6638 ± 0.0001 Å |
| b |
19.9429 ± 0.0002 Å |
| c |
13.5225 ± 0.0001 Å |
| α |
90° |
| β |
94.937 ± 0.001° |
| γ |
90° |
| Cell volume |
2327.77 ± 0.04 Å3 |
| Cell temperature |
100 ± 1 K |
| Ambient diffraction temperature |
100 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0624 |
| Residual factor for significantly intense reflections |
0.0363 |
| Weighted residual factors for significantly intense reflections |
0.0742 |
| Weighted residual factors for all reflections included in the refinement |
0.0845 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.025 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234719.html