Information card for entry 2234724
| Chemical name |
4,5-Dibromo-1,2-dimethyl-1<i>H</i>-imidazol-3-ium bromide |
| Formula |
C5 H7 Br3 N2 |
| Calculated formula |
C5 H7 Br3 N2 |
| SMILES |
Brc1n(c([nH+]c1Br)C)C.[Br-] |
| Title of publication |
4,5-Dibromo-1,2-dimethyl-1<i>H</i>-imidazol-3-ium bromide |
| Authors of publication |
Bahnous, Mebarek; Bouraiou, Abdelmalek; Bouacida, Sofiane; Roisnel, Thierry; Belfaitah, Ali |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
5 |
| Pages of publication |
o1391 |
| a |
5.5938 ± 0.0003 Å |
| b |
11.2522 ± 0.0006 Å |
| c |
14.4864 ± 0.0009 Å |
| α |
90° |
| β |
104.571 ± 0.003° |
| γ |
90° |
| Cell volume |
882.48 ± 0.09 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0355 |
| Residual factor for significantly intense reflections |
0.0269 |
| Weighted residual factors for significantly intense reflections |
0.0575 |
| Weighted residual factors for all reflections included in the refinement |
0.0601 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234724.html