Information card for entry 2234729
| Chemical name |
(<i>Z</i>)-1,3-Bis(4-chlorophenyl)-2-(1<i>H</i>-1,2,4-triazol-1-yl)prop-2-en- 1-one |
| Formula |
C17 H11 Cl2 N3 O |
| Calculated formula |
C17 H11 Cl2 N3 O |
| SMILES |
Clc1ccc(cc1)C(=O)/C(=C/c1ccc(Cl)cc1)n1cncn1 |
| Title of publication |
(<i>Z</i>)-1,3-Bis(4-chlorophenyl)-2-(1<i>H</i>-1,2,4-triazol-1-yl)prop-2-en-1-one |
| Authors of publication |
Dai, Ling-Ling; Yin, Ben-Tao; Lv, Jing-Song; Cui, Sheng-Feng; Zhou, Cheng-He |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
5 |
| Pages of publication |
o1456 |
| a |
5.588 ± 0.003 Å |
| b |
11.85 ± 0.007 Å |
| c |
12.653 ± 0.008 Å |
| α |
74.787 ± 0.01° |
| β |
88.884 ± 0.009° |
| γ |
86.461 ± 0.009° |
| Cell volume |
806.9 ± 0.8 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0479 |
| Residual factor for significantly intense reflections |
0.0371 |
| Weighted residual factors for significantly intense reflections |
0.0971 |
| Weighted residual factors for all reflections included in the refinement |
0.105 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.022 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234729.html