Information card for entry 2234732
| Chemical name |
2-<i>N</i>-Benzyl-2,6-dideoxy-2,6-imino-3,4-<i>O</i>-isopropylidene- 3-<i>C</i>-methyl-<i>D</i>-allononitrile |
| Formula |
C17 H22 N2 O3 |
| Calculated formula |
C17 H22 N2 O3 |
| SMILES |
O[C@@H]1CN(Cc2ccccc2)[C@@H](C#N)[C@]2([C@@H]1OC(O2)(C)C)C |
| Title of publication |
2-<i>N</i>-Benzyl-2,6-dideoxy-2,6-imino-3,4-<i>O</i>-isopropylidene-3-<i>C</i>-methyl-<small>D</small>-allononitrile |
| Authors of publication |
Ayers, Benjamin J.; Jenkinson, Sarah F.; Fleet, George W. J.; Thompson, Amber L. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
5 |
| Pages of publication |
o1474 |
| a |
8.5647 ± 0.0003 Å |
| b |
10.0019 ± 0.0004 Å |
| c |
18.7031 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1602.17 ± 0.1 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0494 |
| Residual factor for significantly intense reflections |
0.0405 |
| Weighted residual factors for all reflections |
0.1064 |
| Weighted residual factors for significantly intense reflections |
0.1001 |
| Weighted residual factors for all reflections included in the refinement |
0.1064 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9711 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234732.html