Information card for entry 2234817
| Chemical name |
(<i>E</i>)-3-(2-Chlorophenyl)-1-(4,4''-difluoro-5'-methoxy-1,1':3',1''-terphenyl-4'-yl)prop-2-en-1-one |
| Formula |
C28 H19 Cl F2 O2 |
| Calculated formula |
C28 H19 Cl F2 O2 |
| SMILES |
Clc1c(/C=C/C(=O)c2c(cc(cc2OC)c2ccc(F)cc2)c2ccc(F)cc2)cccc1 |
| Title of publication |
(<i>E</i>)-3-(2-Chlorophenyl)-1-(4,4''-difluoro-5'-methoxy-1,1':3',1''-terphenyl-4'-yl)prop-2-en-1-one |
| Authors of publication |
Samshuddin, S.; Narayana, Badiadka; Yathirajan, Hemmige S.; Betz, Richard; Gerber, Thomas; Hosten, Eric |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
5 |
| Pages of publication |
o1538 - o1539 |
| a |
14.2065 ± 0.0007 Å |
| b |
6.8651 ± 0.0003 Å |
| c |
22.4817 ± 0.0011 Å |
| α |
90° |
| β |
101.406 ± 0.002° |
| γ |
90° |
| Cell volume |
2149.32 ± 0.18 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0933 |
| Residual factor for significantly intense reflections |
0.0636 |
| Weighted residual factors for significantly intense reflections |
0.1291 |
| Weighted residual factors for all reflections included in the refinement |
0.1406 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234817.html