Information card for entry 2234938
| Chemical name |
2-Methylsulfonyl-1,2,4-triazolo[1,5-<i>a</i>]quinazolin-5(4<i>H</i>)-one |
| Formula |
C10 H8 N4 O3 S |
| Calculated formula |
C10 H8 N4 O3 S |
| SMILES |
S(=O)(=O)(c1nn2c3c(C(=O)Nc2n1)cccc3)C |
| Title of publication |
2-Methylsulfonyl-1,2,4-triazolo[1,5-<i>a</i>]quinazolin-5(4<i>H</i>)-one |
| Authors of publication |
Al-Salahi, Rashad; Marzouk, Mohamed; Abbas, Mohammed; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
o1806 |
| a |
9.6216 ± 0.0002 Å |
| b |
4.9206 ± 0.0001 Å |
| c |
12.1623 ± 0.0003 Å |
| α |
90° |
| β |
106.628 ± 0.002° |
| γ |
90° |
| Cell volume |
551.73 ± 0.02 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0311 |
| Residual factor for significantly intense reflections |
0.0299 |
| Weighted residual factors for significantly intense reflections |
0.0807 |
| Weighted residual factors for all reflections included in the refinement |
0.082 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234938.html