Information card for entry 2234940
| Chemical name |
2-Phenoxy-1,2,4-triazolo[1,5-<i>a</i>]quinazolin-5(4<i>H</i>)-one |
| Formula |
C15 H10 N4 O2 |
| Calculated formula |
C15 H10 N4 O2 |
| SMILES |
O=C1Nc2n(nc(Oc3ccccc3)n2)c2c1cccc2 |
| Title of publication |
2-Phenoxy-1,2,4-triazolo[1,5-<i>a</i>]quinazolin-5(4<i>H</i>)-one |
| Authors of publication |
Al-Salahi, Rashad; Nabih, Lolak; Al-Omar, Mohamed; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
o1808 |
| a |
5.6985 ± 0.0002 Å |
| b |
8.4328 ± 0.0004 Å |
| c |
13.4322 ± 0.0007 Å |
| α |
74.087 ± 0.004° |
| β |
86.623 ± 0.004° |
| γ |
89.284 ± 0.004° |
| Cell volume |
619.66 ± 0.05 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0366 |
| Residual factor for significantly intense reflections |
0.0349 |
| Weighted residual factors for significantly intense reflections |
0.1006 |
| Weighted residual factors for all reflections included in the refinement |
0.1029 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.026 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234940.html