Information card for entry 2234948
| Chemical name |
2-(3-Chloro-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-5-yl)-2-methylpropanenitrile |
| Formula |
C19 H17 Cl N4 |
| Calculated formula |
C19 H17 Cl N4 |
| SMILES |
ClC1=NC(C(=NN1)c1ccccc1)(C(C#N)(C)C)c1ccccc1 |
| Title of publication |
2-(3-Chloro-5,6-diphenyl-2,5-dihydro-1,2,4-triazin-5-yl)-2-methylpropanenitrile |
| Authors of publication |
Wolińska, Ewa; Karczmarzyk, Zbigniew; Rykowski, Andrzej; Urbańczyk-Lipkowska, Zofia; Kalicki, Przemysław |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
o1938 |
| a |
8.2422 ± 0.0001 Å |
| b |
13.9124 ± 0.0002 Å |
| c |
15.4685 ± 0.0003 Å |
| α |
90° |
| β |
93.855 ± 0.001° |
| γ |
90° |
| Cell volume |
1769.74 ± 0.05 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0393 |
| Residual factor for significantly intense reflections |
0.0369 |
| Weighted residual factors for significantly intense reflections |
0.1075 |
| Weighted residual factors for all reflections included in the refinement |
0.1103 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234948.html