Information card for entry 2234958
| Chemical name |
1-{[(2,3-Dihydro-1<i>H</i>-inden-2-yl)oxy]methyl}quinazoline- 2,4(1<i>H</i>,3<i>H</i>)-dione |
| Formula |
C18 H16 N2 O3 |
| Calculated formula |
C18 H16 N2 O3 |
| SMILES |
C1(Cc2ccccc2C1)OCN1C(=O)NC(=O)c2ccccc12 |
| Title of publication |
1-{[(2,3-Dihydro-1<i>H</i>-inden-2-yl)oxy]methyl}quinazoline-2,4(1<i>H</i>,3<i>H</i>)-dione |
| Authors of publication |
El-Brollosy, Nasser R.; Dege, Necmi; Demirtaş, Güneş; Attia, Mohamed I.; El-Emam, Ali A.; Büyükgüngör, Orhan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
o1866 - o1867 |
| a |
7.6684 ± 0.0008 Å |
| b |
10.0717 ± 0.001 Å |
| c |
10.6748 ± 0.0011 Å |
| α |
87.199 ± 0.008° |
| β |
78.332 ± 0.008° |
| γ |
70.569 ± 0.008° |
| Cell volume |
761.28 ± 0.14 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0803 |
| Residual factor for significantly intense reflections |
0.0441 |
| Weighted residual factors for significantly intense reflections |
0.092 |
| Weighted residual factors for all reflections included in the refinement |
0.1028 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234958.html