Information card for entry 2234983
| Chemical name |
(<i>E</i>)-3,3,6,6-Tetramethyl-9-(2-nitrostyryl)-3,4,5,6,7,9-hexahydro- 1<i>H</i>-xanthene-1,8(2<i>H</i>)-dione |
| Formula |
C25 H27 N O5 |
| Calculated formula |
C25 H27 N O5 |
| SMILES |
O1C2=C(C(C3=C1CC(CC3=O)(C)C)/C=C/c1ccccc1N(=O)=O)C(=O)CC(C2)(C)C |
| Title of publication |
(<i>E</i>)-3,3,6,6-Tetramethyl-9-(2-nitrostyryl)-3,4,5,6,7,9-hexahydro-1<i>H</i>-xanthene-1,8(2<i>H</i>)-dione |
| Authors of publication |
Lee, Jae Kyun; Min, Sun-Joon; Cho, Yong Seo; Lee, Ki Soo; Cha, Joo Hwan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
o1947 |
| a |
33.312 ± 0.003 Å |
| b |
9.4144 ± 0.0006 Å |
| c |
14.4581 ± 0.001 Å |
| α |
90° |
| β |
102.393 ± 0.0019° |
| γ |
90° |
| Cell volume |
4428.6 ± 0.6 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for significantly intense reflections |
0.048 |
| Weighted residual factors for all reflections included in the refinement |
0.1531 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2234983.html