Information card for entry 2235036
| Chemical name |
(<i>E</i>)-2-Cyano-<i>N</i>'-(1,2,3,4-tetrahydronaphthalen-1- ylidene)acetohydrazide |
| Formula |
C13 H13 N3 O |
| Calculated formula |
C13 H13 N3 O |
| SMILES |
O=C(N/N=C/1CCCc2c1cccc2)CC#N |
| Title of publication |
(<i>E</i>)-2-Cyano-<i>N</i>'-(1,2,3,4-tetrahydronaphthalen-1-ylidene)acetohydrazide |
| Authors of publication |
Al-Omar, Mohamed A.; Khalifa, Nagy M.; Ghabbour, Hazem A.; Chia, Tze Shyang; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
o1740 |
| a |
7.6414 ± 0.0001 Å |
| b |
7.6748 ± 0.0001 Å |
| c |
10.5644 ± 0.0002 Å |
| α |
109.589 ± 0.001° |
| β |
91.405 ± 0.001° |
| γ |
93.26 ± 0.001° |
| Cell volume |
582.132 ± 0.016 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0448 |
| Residual factor for significantly intense reflections |
0.0427 |
| Weighted residual factors for significantly intense reflections |
0.1181 |
| Weighted residual factors for all reflections included in the refinement |
0.1204 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.049 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235036.html