Information card for entry 2235085
| Chemical name |
Tris(5,6-dimethyl-1<i>H</i>-benzimidazole-κ<i>N</i>^3^)(pyridine-2,6- dicarboxylato-κ^3^<i>O</i>^2^,<i>N</i>,<i>O</i>^6^)nickel(II) |
| Formula |
C34 H33 N7 Ni O4 |
| Calculated formula |
C34 H33 N7 Ni O4 |
| SMILES |
[Ni]12([n]3c(C(=O)O1)cccc3C(=O)O2)([n]1c2cc(c(cc2[nH]c1)C)C)([n]1c2cc(C)c(cc2[nH]c1)C)[n]1c[nH]c2cc(c(cc12)C)C |
| Title of publication |
Tris(5,6-dimethyl-1<i>H</i>-benzimidazole-κ<i>N</i>^3^)(pyridine-2,6-dicarboxylato-κ^3^<i>O</i>^2^,<i>N</i>,<i>O</i>^6^)nickel(II) |
| Authors of publication |
Li, Yue-Hua; Li, Feng-Feng; Liu, Xin-Hua; Zhao, Ling-Yan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
m739 |
| a |
7.5884 ± 0.0007 Å |
| b |
9.4499 ± 0.0009 Å |
| c |
23.839 ± 0.002 Å |
| α |
89.004 ± 0.0009° |
| β |
81.484 ± 0.001° |
| γ |
74.078 ± 0.001° |
| Cell volume |
1625.3 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0369 |
| Residual factor for significantly intense reflections |
0.0318 |
| Weighted residual factors for significantly intense reflections |
0.0828 |
| Weighted residual factors for all reflections included in the refinement |
0.0868 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.943 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235085.html