Information card for entry 2235138
| Chemical name |
Tris(1<i>H</i>-benzimidazole-κ<i>N</i>^3^)(pyridine-2,6-dicarboxylato- κ^3^<i>O</i>^2^,<i>N</i>,<i>O</i>^6^)nickel(II) |
| Formula |
C28 H21 N7 Ni O4 |
| Calculated formula |
C28 H21 N7 Ni O4 |
| SMILES |
[Ni]12(OC(=O)c3[n]1c(ccc3)C(=O)O2)([n]1c2c([nH]c1)cccc2)([n]1c2ccccc2[nH]c1)[n]1c2c([nH]c1)cccc2 |
| Title of publication |
Tris(1<i>H</i>-benzimidazole-κ<i>N</i>^3^)(pyridine-2,6-dicarboxylato-κ^3^<i>O</i>^2^,<i>N</i>,<i>O</i>^6^)nickel(II) |
| Authors of publication |
Li, Yue-Hua; Li, Feng-Feng; Liu, Xin-Hua; Zhao, Ling-Yan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
m740 |
| a |
9.4546 ± 0.0019 Å |
| b |
10.487 ± 0.002 Å |
| c |
27.532 ± 0.005 Å |
| α |
90° |
| β |
98.94 ± 0.03° |
| γ |
90° |
| Cell volume |
2696.6 ± 0.9 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1592 |
| Residual factor for significantly intense reflections |
0.0858 |
| Weighted residual factors for significantly intense reflections |
0.1213 |
| Weighted residual factors for all reflections included in the refinement |
0.143 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.119 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235138.html